Products 161633-75-6
CAS 161633-75-6 is the registry number for GUT-70. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methoxy-2,2-dimethyl-6-[(E)-2-methylbut-2-enoyl]-10-propylpyrano[2,3-f]chromen-8-one (CAS 161633-75-6) is a chemical compound with the molecular formula C23H26O5 and a molecular weight of 382.4 g/mol. IUPAC name: 5-methoxy-2,2-dimethyl-6-[(E)-2-methylbut-2-enoyl]-10-propylpyrano[2,3-f]chromen-8-one. InChIKey: RMUWCAYGHBNRQJ-MDWZMJQESA-N.
| Molecular formula | C23H26O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 5-methoxy-2,2-dimethyl-6-[(E)-2-methylbut-2-enoyl]-10-propylpyrano[2,3-f]chromen-8-one |
| InChIKey | RMUWCAYGHBNRQJ-MDWZMJQESA-N |
| SMILES | CCCC1=CC(=O)OC2=C1C3=C(C=CC(O3)(C)C)C(=C2C(=O)/C(=C/C)/C)OC |
Computed by PubChem (NCBI)