CAS 1616383-04-0 is the registry number for bis(tert-butyl 3,3-dimethylpiperazine-1-carboxylate) rel-(2R,3R)-2,3-dihydroxybutanedioic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(tert-butyl 3,3-dimethylpiperazine-1-carboxylate);(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 1616383-04-0) is a chemical compound with the molecular formula C26H50N4O10 and a molecular weight of 578.7 g/mol. IUPAC name: bis(tert-butyl 3,3-dimethylpiperazine-1-carboxylate);(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: NZXBOSRTUQXTHC-CEAXSRTFSA-N.
| Molecular formula | C26H50N4O10 |
|---|---|
| Molecular weight | 578.7 g/mol |
| IUPAC name | bis(tert-butyl 3,3-dimethylpiperazine-1-carboxylate);(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | NZXBOSRTUQXTHC-CEAXSRTFSA-N |
| SMILES | CC1(CN(CCN1)C(=O)OC(C)(C)C)C.CC1(CN(CCN1)C(=O)OC(C)(C)C)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)