Products 1627917-32-1

CAS 1627917-32-1 is the registry number for (10-Methoxyphenanthren-9-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(10-methoxyphenanthren-9-yl)boronic acid (CAS 1627917-32-1) is a chemical compound with the molecular formula C15H13BO3 and a molecular weight of 252.07 g/mol. IUPAC name: (10-methoxyphenanthren-9-yl)boronic acid. InChIKey: MOLKQVLLBJTVHL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13BO3
Molecular weight252.07 g/mol
IUPAC name(10-methoxyphenanthren-9-yl)boronic acid
InChIKeyMOLKQVLLBJTVHL-UHFFFAOYSA-N
SMILESB(C1=C(C2=CC=CC=C2C3=CC=CC=C13)OC)(O)O

Computed by PubChem (NCBI)