CAS 1628606-29-0 is the registry number for Mizolastine Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-2-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one (CAS 1628606-29-0) is a chemical compound with the molecular formula C12H19BN2O3S and a molecular weight of 282.17 g/mol. IUPAC name: 3-methyl-2-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one. InChIKey: GIJGIDXVYIFVRK-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O3S |
|---|---|
| Molecular weight | 282.17 g/mol |
| IUPAC name | 3-methyl-2-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one |
| InChIKey | GIJGIDXVYIFVRK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N(C2=O)C)SC |
Computed by PubChem (NCBI)