Products 1655504-96-3
CAS 1655504-96-3 is the registry number for 1-(1，1-Dimethylethyl) 4-(3-bromo-4-carboxyphenyl)-1-piperazinecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid (CAS 1655504-96-3) is a chemical compound with the molecular formula C16H21BrN2O4 and a molecular weight of 385.25 g/mol. IUPAC name: 2-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid. InChIKey: MZNGRBNGYVGABU-UHFFFAOYSA-N.
| Molecular formula | C16H21BrN2O4 |
|---|---|
| Molecular weight | 385.25 g/mol |
| IUPAC name | 2-bromo-4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
| InChIKey | MZNGRBNGYVGABU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)