Products 166411-40-1
CAS 166411-40-1 is the registry number for ((3AS,5S,6aR)-2,2-dimethyl-6-oxotetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aS,5S,6aR)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate (CAS 166411-40-1) is a chemical compound with the molecular formula C15H16O6 and a molecular weight of 292.28 g/mol. IUPAC name: [(3aS,5S,6aR)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate. InChIKey: YOGBWRUAHKADCO-JKOKRWQUSA-N.
| Molecular formula | C15H16O6 |
|---|---|
| Molecular weight | 292.28 g/mol |
| IUPAC name | [(3aS,5S,6aR)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
| InChIKey | YOGBWRUAHKADCO-JKOKRWQUSA-N |
| SMILES | CC1(O[C@@H]2[C@H](O1)O[C@H](C2=O)COC(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)