Products 1674334-02-1
CAS 1674334-02-1 is the registry number for 10-Bromo-7,7-dimethyl-7H-benzo[c]fluorene, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
10-bromo-7,7-dimethylbenzo[c]fluorene (CAS 1674334-02-1) is a chemical compound with the molecular formula C19H15Br and a molecular weight of 323.2 g/mol. IUPAC name: 10-bromo-7,7-dimethylbenzo[c]fluorene. InChIKey: LTSJBWBNXLBHEU-UHFFFAOYSA-N.
| Molecular formula | C19H15Br |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 10-bromo-7,7-dimethylbenzo[c]fluorene |
| InChIKey | LTSJBWBNXLBHEU-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)C3=C1C=CC4=CC=CC=C43)C |
Computed by PubChem (NCBI)