Products 167631-56-3
CAS 167631-56-3 is the registry number for 3-chloro-5-fluoro-1-methyl-indole-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
3-chloro-5-fluoro-1-methylindole-2-carboxylic acid (CAS 167631-56-3) is a chemical compound with the molecular formula C10H7ClFNO2 and a molecular weight of 227.62 g/mol. IUPAC name: 3-chloro-5-fluoro-1-methylindole-2-carboxylic acid. InChIKey: JGXHIWKPUMSYSB-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO2 |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | 3-chloro-5-fluoro-1-methylindole-2-carboxylic acid |
| InChIKey | JGXHIWKPUMSYSB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)F)C(=C1C(=O)O)Cl |
Computed by PubChem (NCBI)