CAS 1682642-69-8 is the registry number for Solifenacin Related Compound 24. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CAS 1682642-69-8) is a chemical compound with the molecular formula C15H24Cl2N2 and a molecular weight of 303.3 g/mol. IUPAC name: N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride. InChIKey: BABMCKVVGDIUCA-RUINQVFKSA-N.
| Molecular formula | C15H24Cl2N2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| InChIKey | BABMCKVVGDIUCA-RUINQVFKSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC2CN3CCC2CC3.Cl.Cl |
Computed by PubChem (NCBI)