Products 169626-43-1
CAS 169626-43-1 is the registry number for WAY-126299A. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium (2S)-2-[6-(1,3-benzothiazol-2-ylmethoxy)naphthalen-2-yl]-N-methyl-N-oxidopropanamide (CAS 169626-43-1) is a chemical compound with the molecular formula C22H19N2NaO3S and a molecular weight of 414.5 g/mol. IUPAC name: sodium (2S)-2-[6-(1,3-benzothiazol-2-ylmethoxy)naphthalen-2-yl]-N-methyl-N-oxidopropanamide. InChIKey: OKNIRCHGGNQFDK-UQKRIMTDSA-N.
| Molecular formula | C22H19N2NaO3S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | sodium (2S)-2-[6-(1,3-benzothiazol-2-ylmethoxy)naphthalen-2-yl]-N-methyl-N-oxidopropanamide |
| InChIKey | OKNIRCHGGNQFDK-UQKRIMTDSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OCC3=NC4=CC=CC=C4S3)C(=O)N(C)[O-].[Na+] |
Computed by PubChem (NCBI)