Products 171046-15-4
CAS 171046-15-4 is the registry number for FR181157. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2-[3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenoxy]acetate (CAS 171046-15-4) is a chemical compound with the molecular formula C30H26NNaO4 and a molecular weight of 487.5 g/mol. IUPAC name: sodium 2-[3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenoxy]acetate. InChIKey: DPECFBBZFTXROT-JIDHJSLPSA-M.
| Molecular formula | C30H26NNaO4 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | sodium 2-[3-[[(1S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]phenoxy]acetate |
| InChIKey | DPECFBBZFTXROT-JIDHJSLPSA-M |
| SMILES | C1CC=C([C@@H](C1)CC2=CC(=CC=C2)OCC(=O)[O-])C3=NC(=C(O3)C4=CC=CC=C4)C5=CC=CC=C5.[Na+] |
Computed by PubChem (NCBI)