Products 1711867-43-4
CAS 1711867-43-4 is the registry number for 4-BROMO-2-(2,2,2-TRIFLUOROETHOXY)BENZONITRILE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2-(2,2,2-trifluoroethoxy)benzonitrile (CAS 1711867-43-4) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 4-bromo-2-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: LTGCRGUUHCPENL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 4-bromo-2-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | LTGCRGUUHCPENL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OCC(F)(F)F)C#N |
Computed by PubChem (NCBI)