Products 173522-96-8
CAS 173522-96-8 appears in our catalog under these names: Lamivudine salicylate, 95%, Lamivudine salicylate, Lamivudine (salicylate). Offered by: Combi-blocks, TargetMol, MedChemExpress. Available pack sizes: 1g, 100mg, 25mg, 50mg, Get quote.
[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl 2-hydroxybenzoate (CAS 173522-96-8) is a chemical compound with the molecular formula C15H15N3O5S and a molecular weight of 349.4 g/mol. IUPAC name: [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl 2-hydroxybenzoate. InChIKey: MUAWHSKZVSAWMH-QWHCGFSZSA-N.
| Molecular formula | C15H15N3O5S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl 2-hydroxybenzoate |
| InChIKey | MUAWHSKZVSAWMH-QWHCGFSZSA-N |
| SMILES | C1[C@H](O[C@H](S1)COC(=O)C2=CC=CC=C2O)N3C=CC(=NC3=O)N |
Computed by PubChem (NCBI)