Products 1770189-57-5
CAS 1770189-57-5 is the registry number for 4-(5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)aniline (CAS 1770189-57-5) is a chemical compound with the molecular formula C20H25N and a molecular weight of 279.4 g/mol. IUPAC name: 4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)aniline. InChIKey: KVZGACKZAGBXEO-UHFFFAOYSA-N.
| Molecular formula | C20H25N |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | 4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)aniline |
| InChIKey | KVZGACKZAGBXEO-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C3=CC=C(C=C3)N)(C)C)C |
Computed by PubChem (NCBI)