Products 1773508-35-2
CAS 1773508-35-2 is the registry number for diisopropyl 3,3-dimethylcyclobutane-1,1-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Dipropan-2-yl 3,3-dimethylcyclobutane-1,1-dicarboxylate (CAS 1773508-35-2) is a chemical compound with the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. IUPAC name: dipropan-2-yl 3,3-dimethylcyclobutane-1,1-dicarboxylate. InChIKey: JTWZGEQKGZCISX-UHFFFAOYSA-N.
| Molecular formula | C14H24O4 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | dipropan-2-yl 3,3-dimethylcyclobutane-1,1-dicarboxylate |
| InChIKey | JTWZGEQKGZCISX-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(C1)(C)C)C(=O)OC(C)C |
Computed by PubChem (NCBI)