Products 1784747-72-3
CAS 1784747-72-3 is the registry number for Rel-methyl (3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylate (CAS 1784747-72-3) is a chemical compound with the molecular formula C15H16FNO3 and a molecular weight of 277.29 g/mol. IUPAC name: methyl (3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylate. InChIKey: AUQAAKKFLQYYMG-DGCLKSJQSA-N.
| Molecular formula | C15H16FNO3 |
|---|---|
| Molecular weight | 277.29 g/mol |
| IUPAC name | methyl (3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylate |
| InChIKey | AUQAAKKFLQYYMG-DGCLKSJQSA-N |
| SMILES | COC(=O)[C@@H]1[C@H](CNC1=O)C2=C(C=C3CCCC3=C2)F |
Computed by PubChem (NCBI)