CAS 1792234-14-0 is the registry number for Apremilast Impurity 103. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-acetamido-N-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylpentanamide (CAS 1792234-14-0) is a chemical compound with the molecular formula C20H32N2O6S and a molecular weight of 428.5 g/mol. IUPAC name: (2S)-2-acetamido-N-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylpentanamide. InChIKey: PFKZENURTVAUOP-BHWOMJMDSA-N.
| Molecular formula | C20H32N2O6S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | (2S)-2-acetamido-N-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylpentanamide |
| InChIKey | PFKZENURTVAUOP-BHWOMJMDSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(CS(=O)(=O)C)NC(=O)[C@H](CC(C)C)NC(=O)C)OC |
Computed by PubChem (NCBI)