CAS 1794828-59-3 is the registry number for JWH-175-d11. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
3-(naphthalen-1-ylmethyl)-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indole (CAS 1794828-59-3) is a chemical compound with the molecular formula C24H25N and a molecular weight of 338.5 g/mol. IUPAC name: 3-(naphthalen-1-ylmethyl)-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indole. InChIKey: TYBRSILIYTUTSQ-IHULVLPZSA-N.
| Molecular formula | C24H25N |
|---|---|
| Molecular weight | 338.5 g/mol |
| IUPAC name | 3-(naphthalen-1-ylmethyl)-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indole |
| InChIKey | TYBRSILIYTUTSQ-IHULVLPZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N1C=C(C2=CC=CC=C21)CC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)