CAS 1797883-99-8 is the registry number for KWG 1342 Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 75mg.
Sodium [1-(4-chlorophenoxy)-4-hydroxy-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl] sulfate (CAS 1797883-99-8) is a chemical compound with the molecular formula C14H17ClN3NaO6S and a molecular weight of 413.8 g/mol. IUPAC name: sodium [1-(4-chlorophenoxy)-4-hydroxy-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl] sulfate. InChIKey: TZJUSRCGDLGWHX-UHFFFAOYSA-M.
| Molecular formula | C14H17ClN3NaO6S |
|---|---|
| Molecular weight | 413.8 g/mol |
| IUPAC name | sodium [1-(4-chlorophenoxy)-4-hydroxy-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl] sulfate |
| InChIKey | TZJUSRCGDLGWHX-UHFFFAOYSA-M |
| SMILES | CC(C)(CO)C(C(N1C=NC=N1)OC2=CC=C(C=C2)Cl)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)