CAS 1799740-98-9 is the registry number for 2',3''-Dimethyl-[1,1':4',1'':4'',1'''-quaterphenyl]-4,4'''-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-(4-carboxyphenyl)-3-methylphenyl]-2-methylphenyl]benzoic acid (CAS 1799740-98-9) is a chemical compound with the molecular formula C28H22O4 and a molecular weight of 422.5 g/mol. IUPAC name: 4-[4-[4-(4-carboxyphenyl)-3-methylphenyl]-2-methylphenyl]benzoic acid. InChIKey: BVGRZCJELKDZJS-UHFFFAOYSA-N.
| Molecular formula | C28H22O4 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 4-[4-[4-(4-carboxyphenyl)-3-methylphenyl]-2-methylphenyl]benzoic acid |
| InChIKey | BVGRZCJELKDZJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)C3=CC=C(C=C3)C(=O)O)C)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)