Products 1801911-86-3
CAS 1801911-86-3 is the registry number for NY-0173. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1E)-2-(5-cyclohexyl-1,2-oxazol-3-yl)-2-oxo-N-(3,4,5-trichloroanilino)ethanimidoyl cyanide (CAS 1801911-86-3) is a chemical compound with the molecular formula C18H15Cl3N4O2 and a molecular weight of 425.7 g/mol. IUPAC name: (1E)-2-(5-cyclohexyl-1,2-oxazol-3-yl)-2-oxo-N-(3,4,5-trichloroanilino)ethanimidoyl cyanide. InChIKey: ZHJMSAMEGNFHCK-BUVRLJJBSA-N.
| Molecular formula | C18H15Cl3N4O2 |
|---|---|
| Molecular weight | 425.7 g/mol |
| IUPAC name | (1E)-2-(5-cyclohexyl-1,2-oxazol-3-yl)-2-oxo-N-(3,4,5-trichloroanilino)ethanimidoyl cyanide |
| InChIKey | ZHJMSAMEGNFHCK-BUVRLJJBSA-N |
| SMILES | C1CCC(CC1)C2=CC(=NO2)C(=O)/C(=N/NC3=CC(=C(C(=C3)Cl)Cl)Cl)/C#N |
Computed by PubChem (NCBI)