CAS 1802230-85-8 is the registry number for MDAP-1. Offered by: TRC. Available pack sizes: 25mg.
5-[(1,3-dioxo-2-propylbenzo[de]isoquinolin-6-yl)amino]-2-nitrobenzohydrazide (CAS 1802230-85-8) is a chemical compound with the molecular formula C22H19N5O5 and a molecular weight of 433.4 g/mol. IUPAC name: 5-[(1,3-dioxo-2-propylbenzo[de]isoquinolin-6-yl)amino]-2-nitrobenzohydrazide. InChIKey: PMAQQWVMTZXUSU-UHFFFAOYSA-N.
| Molecular formula | C22H19N5O5 |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 5-[(1,3-dioxo-2-propylbenzo[de]isoquinolin-6-yl)amino]-2-nitrobenzohydrazide |
| InChIKey | PMAQQWVMTZXUSU-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C3C(=C(C=C2)NC4=CC(=C(C=C4)[N+](=O)[O-])C(=O)NN)C=CC=C3C1=O |
Computed by PubChem (NCBI)