Products 1802412-74-3
CAS 1802412-74-3 is the registry number for 2-Bromo-9-methyl-9H-pyrrolo[2,3-b:4,5-c']dipyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
11-bromo-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (CAS 1802412-74-3) is a chemical compound with the molecular formula C11H8BrN3 and a molecular weight of 262.10 g/mol. IUPAC name: 11-bromo-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene. InChIKey: XSDBRVKSBZRJNB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN3 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 11-bromo-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| InChIKey | XSDBRVKSBZRJNB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=NC=C2)C3=C1N=C(C=C3)Br |
Computed by PubChem (NCBI)