Products 1803703-06-1
CAS 1803703-06-1 is the registry number for 4-Chloro-6-(difluoromethyl)nicotinaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-chloro-6-(difluoromethyl)pyridine-3-carbaldehyde (CAS 1803703-06-1) is a chemical compound with the molecular formula C7H4ClF2NO and a molecular weight of 191.56 g/mol. IUPAC name: 4-chloro-6-(difluoromethyl)pyridine-3-carbaldehyde. InChIKey: GYDQSEQKRNRAQI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO |
|---|---|
| Molecular weight | 191.56 g/mol |
| IUPAC name | 4-chloro-6-(difluoromethyl)pyridine-3-carbaldehyde |
| InChIKey | GYDQSEQKRNRAQI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)F)C=O)Cl |
Computed by PubChem (NCBI)