Products 1805597-15-2
CAS 1805597-15-2 is the registry number for methyl 5-bromo-4-fluoro-2-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 5-bromo-4-fluoro-2-nitrobenzoate (CAS 1805597-15-2) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 5-bromo-4-fluoro-2-nitrobenzoate. InChIKey: NZMDRZXCOIKKOT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 5-bromo-4-fluoro-2-nitrobenzoate |
| InChIKey | NZMDRZXCOIKKOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)