Products 1809875-69-1
CAS 1809875-69-1 is the registry number for Bis[4-[(2,6-dimethylphenyl)amino]phenyl]methanone, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Bis[4-(2,6-dimethylanilino)phenyl]methanone (CAS 1809875-69-1) is a chemical compound with the molecular formula C29H28N2O and a molecular weight of 420.5 g/mol. IUPAC name: bis[4-(2,6-dimethylanilino)phenyl]methanone. InChIKey: QXCKPVNGMMAZBI-UHFFFAOYSA-N.
| Molecular formula | C29H28N2O |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | bis[4-(2,6-dimethylanilino)phenyl]methanone |
| InChIKey | QXCKPVNGMMAZBI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=CC=C(C=C2)C(=O)C3=CC=C(C=C3)NC4=C(C=CC=C4C)C |
Computed by PubChem (NCBI)