CAS 1809946-59-5 is the registry number for 5-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1809946-59-5) is a chemical compound with the molecular formula C13H15BBrNO2 and a molecular weight of 307.98 g/mol. IUPAC name: 5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: VQUJXZJJRVUUBD-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrNO2 |
|---|---|
| Molecular weight | 307.98 g/mol |
| IUPAC name | 5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | VQUJXZJJRVUUBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Br)C#N |
Computed by PubChem (NCBI)