Products 1820613-44-2
CAS 1820613-44-2 is the registry number for 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylic acid (CAS 1820613-44-2) is a chemical compound with the molecular formula C11H8BrN3O2 and a molecular weight of 294.10 g/mol. IUPAC name: 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylic acid. InChIKey: HOKVNFFJGXLGQO-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN3O2 |
|---|---|
| Molecular weight | 294.10 g/mol |
| IUPAC name | 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylic acid |
| InChIKey | HOKVNFFJGXLGQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC(=NC=C2C(=O)O)N |
Computed by PubChem (NCBI)