Products 1820619-35-9
CAS 1820619-35-9 is the registry number for methyl 4-chloro-3-(2-methylpropoxy)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-chloro-3-(2-methylpropoxy)benzoate (CAS 1820619-35-9) is a chemical compound with the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. IUPAC name: methyl 4-chloro-3-(2-methylpropoxy)benzoate. InChIKey: CZSIYGVDJMNERJ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO3 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | methyl 4-chloro-3-(2-methylpropoxy)benzoate |
| InChIKey | CZSIYGVDJMNERJ-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=CC(=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)