Products 1820619-54-2

CAS 1820619-54-2 is the registry number for methyl 5-(4-tert-butylphenyl)pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 5-(4-tert-butylphenyl)pyridine-2-carboxylate (CAS 1820619-54-2) is a chemical compound with the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. IUPAC name: methyl 5-(4-tert-butylphenyl)pyridine-2-carboxylate. InChIKey: MNMCFHIGYRRAOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO2
Molecular weight269.34 g/mol
IUPAC namemethyl 5-(4-tert-butylphenyl)pyridine-2-carboxylate
InChIKeyMNMCFHIGYRRAOZ-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)C2=CN=C(C=C2)C(=O)OC

Computed by PubChem (NCBI)