CAS 1820619-85-9 is the registry number for 6-fluoro-1,3-benzoxazole-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-fluoro-1,3-benzoxazole-2,4-diamine (CAS 1820619-85-9) is a chemical compound with the molecular formula C7H6FN3O and a molecular weight of 167.14 g/mol. IUPAC name: 6-fluoro-1,3-benzoxazole-2,4-diamine. InChIKey: NGNPTWSPSMTDRG-UHFFFAOYSA-N.
| Molecular formula | C7H6FN3O |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 6-fluoro-1,3-benzoxazole-2,4-diamine |
| InChIKey | NGNPTWSPSMTDRG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1N)N=C(O2)N)F |
Computed by PubChem (NCBI)