CAS 1820650-83-6 is the registry number for 8-methyl-5-nitro-[1,3]oxazolo[4,5-h]quinolin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-methyl-5-nitro-[1,3]oxazolo[4,5-h]quinolin-2-amine (CAS 1820650-83-6) is a chemical compound with the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. IUPAC name: 8-methyl-5-nitro-[1,3]oxazolo[4,5-h]quinolin-2-amine. InChIKey: GEWMFKDPESRSFY-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O3 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 8-methyl-5-nitro-[1,3]oxazolo[4,5-h]quinolin-2-amine |
| InChIKey | GEWMFKDPESRSFY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C3C(=CC(=C2C=C1)[N+](=O)[O-])N=C(O3)N |
Computed by PubChem (NCBI)