Products 1820710-58-4

CAS 1820710-58-4 is the registry number for 2-amino-4-(4-chlorophenyl)pyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-4-(4-chlorophenyl)pyrimidine-5-carboxylic acid (CAS 1820710-58-4) is a chemical compound with the molecular formula C11H8ClN3O2 and a molecular weight of 249.65 g/mol. IUPAC name: 2-amino-4-(4-chlorophenyl)pyrimidine-5-carboxylic acid. InChIKey: BXWOIYCJIOUIDV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClN3O2
Molecular weight249.65 g/mol
IUPAC name2-amino-4-(4-chlorophenyl)pyrimidine-5-carboxylic acid
InChIKeyBXWOIYCJIOUIDV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC(=NC=C2C(=O)O)N)Cl

Computed by PubChem (NCBI)