CAS 1820712-80-8 is the registry number for methyl 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetate (CAS 1820712-80-8) is a chemical compound with the molecular formula C10H6BrF5O3 and a molecular weight of 349.05 g/mol. IUPAC name: methyl 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetate. InChIKey: LQGACBFZBXVHOT-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF5O3 |
|---|---|
| Molecular weight | 349.05 g/mol |
| IUPAC name | methyl 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetate |
| InChIKey | LQGACBFZBXVHOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1)OC(F)(F)F)Br)(F)F |
Computed by PubChem (NCBI)