Products 1821666-73-2
CAS 1821666-73-2 appears in our catalog under these names: Pazopanib Impurity 39, N,2,3-Trimethyl-N-(2-((4-methyl-3-sulfamoylphenyl)amino)pyrimidin-4-yl)-2H-indazol-6-amine oxide, 95%, Pazopanib Impurity 3, 4-Methyloxidoamino Pazopanib. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
N,2,3-trimethyl-N-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]indazol-6-amine oxide (CAS 1821666-73-2) is a chemical compound with the molecular formula C21H23N7O3S and a molecular weight of 453.5 g/mol. IUPAC name: N,2,3-trimethyl-N-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]indazol-6-amine oxide. InChIKey: KIPCSJZOAYPRHI-UHFFFAOYSA-N.
| Molecular formula | C21H23N7O3S |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | N,2,3-trimethyl-N-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]indazol-6-amine oxide |
| InChIKey | KIPCSJZOAYPRHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)[N+](C)(C3=CC4=NN(C(=C4C=C3)C)C)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)