Products 1823271-72-2
CAS 1823271-72-2 is the registry number for tert-Butyl 2-bromo-1-methyl-1,4,6,7-tetrahydro-5H-imidazo[4,5-c]pyridine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-bromo-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate (CAS 1823271-72-2) is a chemical compound with the molecular formula C12H18BrN3O2 and a molecular weight of 316.19 g/mol. IUPAC name: tert-butyl 2-bromo-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate. InChIKey: LYFORRDUWOVTNT-UHFFFAOYSA-N.
| Molecular formula | C12H18BrN3O2 |
|---|---|
| Molecular weight | 316.19 g/mol |
| IUPAC name | tert-butyl 2-bromo-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
| InChIKey | LYFORRDUWOVTNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(N2C)Br |
Computed by PubChem (NCBI)