CAS 1823409-07-9 is the registry number for 5-(4-(Methylthio)phenyl)thiazol-2-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-(4-methylsulfanylphenyl)-1,3-thiazol-2-amine (CAS 1823409-07-9) is a chemical compound with the molecular formula C10H10N2S2 and a molecular weight of 222.3 g/mol. IUPAC name: 5-(4-methylsulfanylphenyl)-1,3-thiazol-2-amine. InChIKey: UNBJEHHZYMGTDI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 5-(4-methylsulfanylphenyl)-1,3-thiazol-2-amine |
| InChIKey | UNBJEHHZYMGTDI-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=CN=C(S2)N |
Computed by PubChem (NCBI)