Products 1824468-68-9
CAS 1824468-68-9 is the registry number for 1,1-DIMETHYLETHYL 3-(2,2-DIMETHYL-1-OXOPROPYL)-3,8-DIAZABICYCLO[3.2.1]OCTANE-8-CARBOXYLATE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(2,2-dimethylpropanoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 1824468-68-9) is a chemical compound with the molecular formula C16H28N2O3 and a molecular weight of 296.40 g/mol. IUPAC name: tert-butyl 3-(2,2-dimethylpropanoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: GGLTZUULHTVOSE-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O3 |
|---|---|
| Molecular weight | 296.40 g/mol |
| IUPAC name | tert-butyl 3-(2,2-dimethylpropanoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | GGLTZUULHTVOSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CC2CCC(C1)N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)