CAS 1824632-48-5 appears in our catalog under these names: 2-Bromo-5,7-dichlorothiazolo(5,4-b)pyridine, 95+%, 2-Bromo-5,7-dichlorothiazolo[5,4-b]pyridine, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-5,7-dichloro-[1,3]thiazolo[5,4-b]pyridine (CAS 1824632-48-5) is a chemical compound with the molecular formula C6HBrCl2N2S and a molecular weight of 283.96 g/mol. IUPAC name: 2-bromo-5,7-dichloro-[1,3]thiazolo[5,4-b]pyridine. InChIKey: FPBJVSVKOBFFHZ-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2N2S |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | 2-bromo-5,7-dichloro-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | FPBJVSVKOBFFHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N=C1Cl)SC(=N2)Br)Cl |
Computed by PubChem (NCBI)