CAS 1827389-07-0 is the registry number for 2-[[2-(2-CHLORO-4-NITROPHENYL)ACETYL]AMINO]-5-METHYLBENZOIC ACID, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-5-methylbenzoic acid (CAS 1827389-07-0) is a chemical compound with the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. IUPAC name: 2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-5-methylbenzoic acid. InChIKey: OIBXDWAXQNZRDW-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O5 |
|---|---|
| Molecular weight | 348.74 g/mol |
| IUPAC name | 2-[[2-(2-chloro-4-nitrophenyl)acetyl]amino]-5-methylbenzoic acid |
| InChIKey | OIBXDWAXQNZRDW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CC2=C(C=C(C=C2)[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)