CAS 182822-62-4 appears in our catalog under these names: CP-141938, CP 141938. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1mg.
N-[4-methoxy-3-[[[(2S,3S)-2-phenylpiperidin-3-yl]amino]methyl]phenyl]-N-methylmethanesulfonamide (CAS 182822-62-4) is a chemical compound with the molecular formula C21H29N3O3S and a molecular weight of 403.5 g/mol. IUPAC name: N-[4-methoxy-3-[[[(2S,3S)-2-phenylpiperidin-3-yl]amino]methyl]phenyl]-N-methylmethanesulfonamide. InChIKey: GZLOIBNBDUHEFY-FPOVZHCZSA-N.
| Molecular formula | C21H29N3O3S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | N-[4-methoxy-3-[[[(2S,3S)-2-phenylpiperidin-3-yl]amino]methyl]phenyl]-N-methylmethanesulfonamide |
| InChIKey | GZLOIBNBDUHEFY-FPOVZHCZSA-N |
| SMILES | CN(C1=CC(=C(C=C1)OC)CN[C@H]2CCCN[C@H]2C3=CC=CC=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)