Products 1831167-97-5
CAS 1831167-97-5 is the registry number for DDP-38003. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-4-(4-methylpiperazin-1-yl)benzamide (CAS 1831167-97-5) is a chemical compound with the molecular formula C21H26N4O and a molecular weight of 350.5 g/mol. IUPAC name: N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-4-(4-methylpiperazin-1-yl)benzamide. InChIKey: SSWIQIUOBLUKHT-VQTJNVASSA-N.
| Molecular formula | C21H26N4O |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-4-(4-methylpiperazin-1-yl)benzamide |
| InChIKey | SSWIQIUOBLUKHT-VQTJNVASSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)C(=O)NC3=CC=C(C=C3)[C@@H]4C[C@H]4N |
Computed by PubChem (NCBI)