Products 1852-41-1
CAS 1852-41-1 appears in our catalog under these names: Androsterone sulfate sodium, min. 95 %, 1 mg, Androsterone sulfate sodium, Androsterone sulfate sodium, min. 95 %, 2 mg, Androsterone sulfate sodium, min. 95 %, 5 mg, Androsterone sulfate sodium, min. 95 %, 10 mg. Offered by: Roth, Biosynth. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg.
Sodium (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) sulfate (CAS 1852-41-1) is a chemical compound with the molecular formula C19H29NaO5S and a molecular weight of 392.5 g/mol. IUPAC name: sodium (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) sulfate. InChIKey: CZADSKBJSXZLIB-UHFFFAOYSA-M.
| Molecular formula | C19H29NaO5S |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | sodium (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) sulfate |
| InChIKey | CZADSKBJSXZLIB-UHFFFAOYSA-M |
| SMILES | CC12CCC(CC1CCC3C2CCC4(C3CCC4=O)C)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)