Products 1864058-45-6
CAS 1864058-45-6 is the registry number for 3-({7-Methyl-(1,2,4)triazolo(1,5-a)pyridin-5-yl}amino)propanoic acid, trifluoroacetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid (CAS 1864058-45-6) is a chemical compound with the molecular formula C12H13F3N4O4 and a molecular weight of 334.25 g/mol. IUPAC name: 3-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid. InChIKey: MPNRFDFIRIIRQR-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N4O4 |
|---|---|
| Molecular weight | 334.25 g/mol |
| IUPAC name | 3-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | MPNRFDFIRIIRQR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=NN2C(=C1)NCCC(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)