CAS 18718-07-5 appears in our catalog under these names: Manganese dihydrogen phosphate, 98.0%, Manganese dihydrogen phosphate, ≥99%, Manganese phosphate acid P2O5:46-52%, Manganese phosphate acid, P2O5:46-52%. Offered by: MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1 kg, 500 g, 100g, 500g, 1kg, 1000g.
Manganese(2+) diphosphate (CAS 18718-07-5) is a chemical compound with the molecular formula MnO8P2-4 and a molecular weight of 244.88 g/mol. IUPAC name: manganese(2+) diphosphate. InChIKey: NAAXGLXYRDSIRS-UHFFFAOYSA-H.
| Molecular formula | MnO8P2-4 |
|---|---|
| Molecular weight | 244.88 g/mol |
| IUPAC name | manganese(2+) diphosphate |
| InChIKey | NAAXGLXYRDSIRS-UHFFFAOYSA-H |
| SMILES | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Mn+2] |
Computed by PubChem (NCBI)