CAS 1875078-61-7 appears in our catalog under these names: BCAT–IN–1, BCAT-IN-1, 96%, 96%, BCAT-IN-1, 98.06%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 25 mg, 50 mg, 10 mg.
1-[(1R,3S)-3-[(5-bromothiophene-2-carbonyl)amino]cyclohexyl]-N-methyl-2-pyridin-2-ylbenzimidazole-5-carboxamide (CAS 1875078-61-7) is a chemical compound with the molecular formula C25H24BrN5O2S and a molecular weight of 538.5 g/mol. IUPAC name: 1-[(1R,3S)-3-[(5-bromothiophene-2-carbonyl)amino]cyclohexyl]-N-methyl-2-pyridin-2-ylbenzimidazole-5-carboxamide. InChIKey: PGSKODUPOMCUEJ-DLBZAZTESA-N.
| Molecular formula | C25H24BrN5O2S |
|---|---|
| Molecular weight | 538.5 g/mol |
| IUPAC name | 1-[(1R,3S)-3-[(5-bromothiophene-2-carbonyl)amino]cyclohexyl]-N-methyl-2-pyridin-2-ylbenzimidazole-5-carboxamide |
| InChIKey | PGSKODUPOMCUEJ-DLBZAZTESA-N |
| SMILES | CNC(=O)C1=CC2=C(C=C1)N(C(=N2)C3=CC=CC=N3)[C@@H]4CCC[C@@H](C4)NC(=O)C5=CC=C(S5)Br |
Computed by PubChem (NCBI)