Products 1881289-33-3
CAS 1881289-33-3 is the registry number for tert-butyl N-(3-fluoro-4-hydroxyphenyl)-N-propylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(3-fluoro-4-hydroxyphenyl)-N-propylcarbamate (CAS 1881289-33-3) is a chemical compound with the molecular formula C14H20FNO3 and a molecular weight of 269.31 g/mol. IUPAC name: tert-butyl N-(3-fluoro-4-hydroxyphenyl)-N-propylcarbamate. InChIKey: SVGSOGXSZUUDDL-UHFFFAOYSA-N.
| Molecular formula | C14H20FNO3 |
|---|---|
| Molecular weight | 269.31 g/mol |
| IUPAC name | tert-butyl N-(3-fluoro-4-hydroxyphenyl)-N-propylcarbamate |
| InChIKey | SVGSOGXSZUUDDL-UHFFFAOYSA-N |
| SMILES | CCCN(C1=CC(=C(C=C1)O)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)