Products 1881290-55-6
CAS 1881290-55-6 is the registry number for 1-chloro-5-ethoxy-2-fluoro-3-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-5-ethoxy-2-fluoro-3-(trifluoromethyl)benzene (CAS 1881290-55-6) is a chemical compound with the molecular formula C9H7ClF4O and a molecular weight of 242.60 g/mol. IUPAC name: 1-chloro-5-ethoxy-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: RMCUDVWYKOJRFL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF4O |
|---|---|
| Molecular weight | 242.60 g/mol |
| IUPAC name | 1-chloro-5-ethoxy-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | RMCUDVWYKOJRFL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)