CAS 1881321-61-4 is the registry number for 5-chloro-2,3-dimethoxy-4-nitropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-chloro-2,3-dimethoxy-4-nitropyridine (CAS 1881321-61-4) is a chemical compound with the molecular formula C7H7ClN2O4 and a molecular weight of 218.59 g/mol. IUPAC name: 5-chloro-2,3-dimethoxy-4-nitropyridine. InChIKey: HIUZKCBAGIXKEH-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O4 |
|---|---|
| Molecular weight | 218.59 g/mol |
| IUPAC name | 5-chloro-2,3-dimethoxy-4-nitropyridine |
| InChIKey | HIUZKCBAGIXKEH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CN=C1OC)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)