Products 1884645-24-2

CAS 1884645-24-2 is the registry number for Mirabegron Impurity 68. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]-4-oxobutanethioic S-acid (CAS 1884645-24-2) is a chemical compound with the molecular formula C20H24N2O3S and a molecular weight of 372.5 g/mol. IUPAC name: 4-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]-4-oxobutanethioic S-acid. InChIKey: YIEVGGINGYVBGR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H24N2O3S
Molecular weight372.5 g/mol
IUPAC name4-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]-4-oxobutanethioic S-acid
InChIKeyYIEVGGINGYVBGR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CNCCC2=CC=C(C=C2)NC(=O)CCC(=O)S)O

Computed by PubChem (NCBI)